| Identification |
| Name: | Carbonic acid, thio-, bis(anhydrosulfide) with ethylenebis(dithiocarbamic acid), diethyl ester |
| Synonyms: | BRN 1806454;Carbonic acid, thio-, bis(anhydrosulfide) with ethylenebis(dithiocarbamic acid), diethyl ester;Thiocarbonic acid bis(anhydrosulfide) with ethylenebis(dithiocarbamic acid) diethyl ester;AC1MHULH;LS-52121;ethyl 2-(ethoxycarbonylsulfanylcarbothioylamino)ethylcarbamothioylsulfanylformate;19657-27-3 |
| CAS: | 19657-27-3 |
| Molecular Formula: | C10H16N2O4S4 |
| Molecular Weight: | 356.50504 |
| InChI: | InChI=1/C10H16N2O4S4/c1-3-15-9(13)19-7(17)11-5-6-12-8(18)20-10(14)16-4-2/h3-6H2,1-2H3,(H,11,17)(H,12,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 234.3°C |
| Boiling Point: | 463.8°Cat760mmHg |
| Density: | 1.391g/cm3 |
| Refractive index: | 1.617 |
| Flash Point: | 234.3°C |
| Safety Data |
| |
 |
