| Identification | |
| Name: | L-Threonine,N-[(phenylmethoxy)carbonyl]- |
| Synonyms: | Threonine,N-carboxy-, N-benzyl ester, L- (8CI);(2S,3R)-2-[(Benzyloxycarbonyl)amino]-3-hydroxybutanoic acid;Cbz-Thr-OH;N-Benzyloxycarbonyl-L-threonine;N-Carbobenzoxy-L-threonine;N-[(Phenylmethoxy)carbonyl]-L-threonine;NSC 333749;Z-Thr-OH;CBZ-L-Threonine; |
| CAS: | 19728-63-3 |
| EINECS: | 243-258-1 |
| Molecular Formula: | C12H15NO5 |
| Molecular Weight: | 253.25 |
| InChI: | InChI=1/C12H15NO5/c1-8(14)10(11(15)16)13-12(17)18-7-9-5-3-2-4-6-9/h2-6,8,10,14H,7H2,1H3,(H,13,17)(H,15,16)/t8-,10+/m1/s1 |
| Molecular Structure: | ![(C12H15NO5) Threonine,N-carboxy-, N-benzyl ester, L- (8CI);(2S,3R)-2-[(Benzyloxycarbonyl)amino]-3-hydroxybutanoi...](https://img.guidechem.com/casimg/19728-63-3.gif) |
| Properties | |
| Transport: | OTH |
| Density: | 1.309 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -4.7 o (C=4, ACETIC ACID) |
| Solubility: | Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | white to light yellow crystal powder powder |
| Safety Data | |
 |
|
