| Identification |
| Name: | 2-Bromoheptane |
| CAS: | 1974-04-5 |
| EINECS: | 217-824-3 |
| Molecular Formula: | C7H15Br |
| Molecular Weight: | 179.1 |
| InChI: | InChI=1/C7H15Br/c1-3-4-5-6-7(2)8/h7H,3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Melting Point: | 47 |
| Flash Point: | 117 °F |
| Density: | 1.142 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.447 |
| Solubility: | Insoluble |
| Appearance: | Clear, colorless liquid. |
| Packinggroup: | III |
| Flash Point: | 117 °F |
| Storage Temperature: | Conditions of Storage: Keep container closed. Keep away from heat, sparks, and open flame. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
