| Identification | |
| Name: | Acetic acid,2-mercapto-, ester with 1,2,6-hexanetriol (3:1) |
| Synonyms: | Aceticacid, mercapto-, 1,2,6-hexanetriyl ester (9CI); Acetic acid, mercapto-,triester with 1,2,6-hexanetriol (8CI); 1,2,6-Hexanetriol tris(thioglycolate);1,2,6-Hexanetriol trithioglycolate; TTH |
| CAS: | 19759-80-9 |
| EINECS: | 243-275-4 |
| Molecular Formula: | C12H20 O6 S3 |
| Molecular Weight: | 356.4786 |
| InChI: | InChI=1/C12H20O6S3/c13-10(6-19)16-4-2-1-3-9(18-12(15)8-21)5-17-11(14)7-20/h9,19-21H,1-8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 393.6°C |
| Boiling Point: | 499.1°Cat760mmHg |
| Density: | 1.275g/cm3 |
| Refractive index: | 1.531 |
| Flash Point: | 393.6°C |
| Safety Data | |
 |
|
