| Identification |
| Name: | Carbamimidothioic acid,N-phenyl-, ethyl ester |
| Synonyms: | Carbamimidothioicacid, phenyl-, ethyl ester (9CI); Pseudourea, 2-ethyl-1-phenyl-2-thio- (8CI);S-Ethyl-N-phenylisothiourea |
| CAS: | 19801-34-4 |
| Molecular Formula: | C9H12 N2 S |
| Molecular Weight: | 180.27 |
| InChI: | InChI=1/C9H12N2S/c1-2-12-9(10)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 140.9°C |
| Boiling Point: | 309.4°C at 760 mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.573 |
| Flash Point: | 140.9°C |
| Usage: | A potent inhibitor of the human neuronal constitutive and inducible isoforms of nitric oxide synthetase. It also binds competitively with L-Arginine |
| Safety Data |
| |
 |
