| Identification | |
| Name: | [1,1'-Biphenyl]-4-carbonitrile,4'-hydroxy- |
| Synonyms: | 4-Biphenylcarbonitrile,4'-hydroxy- (8CI);4-(4-Hydroxyphenyl)benzonitrile;4-Cyano-4'-hydroxybiphenyl;4-Hydroxy-4'-cyanobiphenyl;4'-Cyanobiphenyl-4-ol;4'-Hydroxy-4-biphenylylcarbonitrile;4'-Hydroxy-4-cyano-1,1'-biphenyl;4'-Hydroxy[1,1'-biphenyl]-4-carbonitrile; |
| CAS: | 19812-93-2 |
| Molecular Formula: | C13H9NO |
| Molecular Weight: | 195.22 |
| InChI: | InChI=1/C13H9NO/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-8,15H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Density: | 1.24 g/cm3 |
| Refractive index: | 1.652 |
| Water Solubility: | slightly soluble |
| Appearance: | light yellow to beige crystalline powder |
| Specification: |
4'-Hydroxy-4-biphenylcarbonitrile (CAS NO.19812-93-2) is also called as Hdroxyphenyl-4)-4 enzonitrile ; 4'-Hdroxybiphenyl-4-carbonitril ; 4'-Hdroxybiphenyl-4-carbonitrile ; 4'-Hdroxy[1,1'-biphenyl]-4-carbonitrile ; 4-Hdroxy-4'-cyanobiphenyl ; 4-Cano-4'-hydroxy-1,1'-biphenyl ; 4-Cano-4'-hydroxybiphenyl . |
| Packinggroup: | III |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
