| Identification | |
| Name: | Ethyl 4-isocyanobenzoate |
| Synonyms: | Ethyl 4-isocyanobenzoate;Benzoic acid, p-isocyano-, ethyl ester;Benzoic acid, 4-isocyano-, ethyl ester;1983-99-9;AC1L3SFJ;AR-1I9260;LS-37747 |
| CAS: | 1983-99-9 |
| Molecular Formula: | C10H9NO2 |
| Molecular Weight: | 175.184 |
| InChI: | InChI=1/C10H9NO2/c1-3-13-10(12)8-4-6-9(11-2)7-5-8/h4-7H,3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Ethyl 4-isocyanobenzoate , its cas register number is 1983-99-9. It also can be called Benzoic acid, p-isocyano-, ethyl ester . Ethyl 4-isocyanobenzoate (CAS NO.11135-81-2) is moderate toxic by subcutaneous route. When heated to decomposition it emits toxic vapors of NOx. |
| Safety Data | |
| Hazard Symbols | |
 |
|
