| Identification |
| Name: | 1(2H)-Naphthalenone,3,4-dihydro-4-methyl- |
| Synonyms: | (RS)-4-Methyl-1-tetralone;3,4-Dihydro-4-methylnaphthalen-1(2H)-one;4-Methyl-3,4-dihydro-2H-naphthalen-1-one;4-Methyl-a-tetralone;4-Methyltetralone;NSC 65631; |
| CAS: | 19832-98-5 |
| EINECS: | 243-355-9 |
| Molecular Formula: | C11H12O |
| Molecular Weight: | 160.21 |
| InChI: | InChI=1/C11H12O/c1-8-6-7-11(12)10-5-3-2-4-9(8)10/h2-5,8H,6-7H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.078 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.56 |
| Solubility: | Insoluble |
| Appearance: | Colorless to light yellow liquid |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| |
 |
