| Identification | |
| Name: | 9-Carboxyfluorene |
| Synonyms: | Fluorene-9-carboxylicacid (6CI,7CI,8CI);9H-Fluorene-9-carboxylicacid;NSC 5322; |
| CAS: | 1989-33-9 |
| EINECS: | 217-866-2 |
| Molecular Formula: | C14H10O2 |
| Molecular Weight: | 210.23 |
| InChI: | InChI=1/C14H10O2/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.333 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | White crystal powder |
| Specification: |
9H-Fluorene-9-carboxylic acid , its CAS NO. is 1989-33-9, the synonyms are EINECS 217-866-2 ; Fluorene-9-carboxylic acid ; NSC 5322 . |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
