| Identification | |
| Name: | 4-Pyridinamine,3-methyl- |
| Synonyms: | 4-Amino-3-methylpyridine;4-Amino-3-picoline;5-22-09-00286 (Beilstein Handbook Reference);BRN 0107957;NSC 52454;Philips 1908; |
| CAS: | 1990-90-5 |
| EINECS: | 217-872-5 |
| Molecular Formula: | C6H8N2 |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C6H8N2/c1-5-4-8-3-2-6(5)7/h2-4H,1H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 106-107oC |
| Density: | 1.068 g/cm3 |
| Refractive index: | 1.574 |
| Specification: |
?4-Amino-3-methylpyridine (CAS NO.1990-90-5)?is also called 3-Methyl-4-pyridinamine ; 4-Amino-3-picoline ; 5-22-09-00286 (Beilstein Handbook Reference) ; BRN 0107957 ; NSC 52454 ; Philips 1908 ; Phillips 1908 .?4-Amino-3-methylpyridine (CAS NO.1990-90-5) is high toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Safety Data | |
 |
|
