| Identification | |
| Name: | Peroxydicarbonic acid,C,C'-bis(1-methylpropyl) ester |
| Synonyms: | Peroxydicarbonicacid, bis(1-methylpropyl) ester (9CI); Peroxydicarbonic acid, di-sec-butylester (8CI); Di-sec-butyl perdicarbonate; Di-sec-butyl peroxydicarbonate;Lupersol 225; Lupersol 225M30; Trigonox SBP |
| CAS: | 19910-65-7 |
| EINECS: | 243-424-3 |
| Molecular Formula: | C10H18 O6 |
| Molecular Weight: | 234.28 |
| InChI: | InChI=1/C10H18O6/c1-5-7(3)13-9(11)15-16-10(12)14-8(4)6-2/h7-8H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3115 |
| Density: | 1.094 g/cm3 |
| Refractive index: | 1.43 |
| Specification: |
Di-sec-butyl peroxydicarbonate is sensitive to heat. Storage of Di-sec-butyl peroxydicarbonate must be done so with stringent temperature control measures. It's explosion hazard is also mitigated by mixing the peroxide in a water slurry. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Safety Data | |
 |
|
