| Identification | |
| Name: | 6H-Purin-6-one,2-amino-9-(2-deoxy-a-D-erythro-pentofuranosyl)-1,9-dihydro- |
| Synonyms: | Guanine,9-(2-deoxy-a-D-erythro-pentofuranosyl)- (8CI) |
| CAS: | 19916-78-0 |
| EINECS: | 213-505-8 |
| Molecular Formula: | C10H13 N5 O4 |
| Molecular Weight: | 267.24 |
| InChI: | InChI=1/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 392.6°C |
| Boiling Point: | 725.5°Cat760mmHg |
| Density: | 2.08g/cm3 |
| Refractive index: | 1.907 |
| Specification: |
2'-Deoxyguanosine with CAS number of 19916-78-0 is also known as Guanine desoxyriboside ; Deoxyguanosine-2'; Dg ; 9-(2'-Deoxy-beta-d-ribofuranosyl)guanine ; A-2'-Deoxyguanosine ; 2'-Deoxyguanosine ; 2'-Deoxy-d-guanosine . |
| Flash Point: | 392.6°C |
| Safety Data | |
 |
|
