1H-Indole,4,6-difluoro-2,3-dihydro- (199526-98-2)

The cas register number of 4,6-Difluoro-2,3-dihydroindole is 199526-98-2. It also can be called as 1H-Indole,4,6-difluoro-2,3-dihydro- and the Systematic name about this chemical is 4,6-difluoro-2,3-dihydro-1H-indole. It belongs to the following product categories, such as Halide, Indole and so on.

Physical properties about 4,6-Difluoro-2,3-dihydroindole are: (1)ACD/LogP: 2.64; (2)ACD/LogD (pH 5.5): 2.63; (3)ACD/LogD (pH 7.4): 2.64; (4)ACD/BCF (pH 5.5): 58.75; (5)ACD/BCF (pH 7.4): 59.36; (6)ACD/KOC (pH 5.5): 640.54; (7)ACD/KOC (pH 7.4): 647.26; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)Polar Surface Area: 12.03Ų; (11)Index of Refraction: 1.516; (12)Molar Refractivity: 37.15 cm³; (13)Molar Volume: 122.9 cm³; (14)Polarizability: 14.72x10^-24cm³; (15)Surface Tension: 35.6 dyne/cm; (16)Enthalpy of Vaporization: 42.61 kJ/mol; (17)Vapour Pressure: 0.557 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Fc1cc(F)cc2NCCc12
(2)InChI: InChI=1/C8H7F2N/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,11H,1-2H2
(3)InChIKey: SPLRNYJYNJAJHJ-UHFFFAOYAZ
(4)Std. InChI: InChI=1S/C8H7F2N/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,11H,1-2H2
(5)Std. InChIKey: SPLRNYJYNJAJHJ-UHFFFAOYSA-N