| Identification | |
| Name: | Benzene,2-bromo-4-chloro-1-fluoro- |
| Synonyms: | 4-Chloro-2-bromo-1-fluorobenzene;2-Bromo-4-chlorofluorobenzene; |
| CAS: | 1996-30-1 |
| Molecular Formula: | C6H3BrClF |
| Molecular Weight: | 209.44 |
| InChI: | InChI=1/C6H3BrClF/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.719 |
| Refractive index: | 1.554 |
| Specification: |
2-Bromo-4-chloro-1-fluorobenzene with cas registry number of 1996-30-1 is also known as 2-Brom-4-chlor-1-fluorbenzol ; 2-Bromo-4-chloro-1-fluorobenzene ; Benzene, 2-bromo-4-chloro-1-fluoro- ; 2-Bromo-4-chloro-1-fluorobenzene 97% ; 2-Fluoro-5-chlorobromobenzene ; 3-Bromo-4-fluorochlorobenzene ; 5-Chloro-2-Fluorobromobenzene . It is a compound which should be stored in a cool, dry place in tightly closed containers. 2-Bromo-4-chloro-1-fluorobenzene with cas registry number of 1996-30-1 is used as a pharmaceutical intermediate . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
