| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedithione |
| Synonyms: | Uracil,2,4-dithio- (6CI,7CI,8CI);2,4-Dimercaptopyrimidine;2,4-Dithiouracil;2,4-Dithioxopyrimidine;2,4-Pyrimidinedithiol;Dithiouracil;NSC 42031; |
| CAS: | 2001-93-6 |
| EINECS: | 217-894-5 |
| Molecular Formula: | C4H4N2S2 |
| Molecular Weight: | 144.22 |
| InChI: | InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 279-281 °C (dec.)(lit.) |
| Flash Point: | 90.3°C |
| Boiling Point: | 225.6°Cat760mmHg |
| Density: | 1.5g/cm3 |
| Refractive index: | 1.776 |
| Appearance: | yellow crystalline powder |
| Specification: |
2,4(1H,3H)-Pyrimidinedithione , its cas register number is 2001-93-6. It also can be called 2,4-Dimercaptopyrimidine ; 2,4-Dithiopyrimidine ; 2,4-Dithiouracil ; 2,4-Dithioxopyrimidine ; 2,4-Pyrimidinedithiol ; Dithiopyrimidine ; and Dithiouracil . |
| Flash Point: | 90.3°C |
| Storage Temperature: | Store Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
