| Identification | |
| CAS: | 2001-96-9 |
| EINECS: | 217-897-1 |
| Molecular Formula: | C11H13NO7 |
| Molecular Weight: | 271.22 |
| InChI: | InChI=1/C11H13NO7/c13-8-5-18-11(10(15)9(8)14)19-7-3-1-6(2-4-7)12(16)17/h1-4,8-11,13-15H,5H2/t8-,9+,10-,11+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 160 °C |
| Flash Point: | 270.2°C |
| Boiling Point: | 523.2°C at 760 mmHg |
| Density: | 1.597g/cm3 |
| Stability: | Freezer |
| Refractive index: | 1.654 |
| Appearance: | off-white to pale yellow solid |
| Specification: | Off-White to Pale Yellow Solid Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 270.2°C |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
