| Identification | |
| Name: | a-D-Xylofuranose,1,2-O-(1-methylethylidene)- |
| Synonyms: | Xylofuranose,1,2-O-isopropylidene- (6CI,7CI);Xylofuranose, 1,2-O-isopropylidene-, a-D- (8CI);1,2-Di-O-isopropylidene-a-D-xylofuranose;1,2-O-Isopropylidene-D-xylofuranose;1,2-O-Isopropylidene-a-D-xylofuranose; |
| CAS: | 20031-21-4 |
| Molecular Formula: | C8H14O5 |
| Molecular Weight: | 190.19 |
| InChI: | InChI=1/C8H14O5/c1-8(2)12-6-5(10)4(3-9)11-7(6)13-8/h4-7,9-10H,3H2,1-2H3/t4-,5-,6+,7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 69-71 oC |
| Boiling Point: | 112-114 oC (0.06 mmHg) |
| Density: | 1.267g/cm3 |
| Alpha: | -19.2 o (C=1 IN H2O) |
| Appearance: | White Crystalline Solid |
| Specification: |
The 1,2-O-Isopropylidene-alpha-D-xylofuranose with the CAS number 20031-21-4 is also called a-D-Xylofuranose,1,2-O-(1-methylethylidene)-. The IUPAC name is (3aR,5R,6S,6aR)-5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol. Its molecular formula is C8H14O5. This chemical belongs to the following product categories: (1)13C & 2H Sugars; (2)Biochemistry; (3)Sugars; (4)Xylose; (5)Carbohydrates & Derivatives; (6)Carbohydrate Synthesis; (7)Monosaccharides; (8)Specialty Synthesis. The properties of the chemical are: (1)ACD/LogP: 0.51; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.51; (4)ACD/LogD (pH 7.4): 0.51; (5)ACD/BCF (pH 5.5): 1.44; (6)ACD/BCF (pH 7.4): 1.44; (7)ACD/KOC (pH 5.5): 45.18; (8)ACD/KOC (pH 7.4): 45.18; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 46.15 Å2; (13)Index of Refraction: 1.485; (14)Molar Refractivity: 43.06 cm3; (15)Molar Volume: 150 cm3; (16)Polarizability: 17.07×10-24cm3; (17)Surface Tension: 47.3 dyne/cm; (18)Enthalpy of Vaporization: 66.72 kJ/mol; (19)Vapour Pressure: 1×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
