| Identification | |
| Name: | Butylate |
| Synonyms: | Carbamicacid, diisobutylthio-, S-ethyl ester (6CI,7CI,8CI); Carbamothioic acid,bis(2-methylpropyl)-, S-ethyl ester (9CI); Anelda; Butilate; Butylate;Diisocarb; Ethyl N,N-diisobutylthiocarbamate; Ethyl-N,N-diisobutylthiolcarbamate; R 1910; S-Ethyl N,N-diisobutylthiocarbamate; S-EthylN,N-diisobutylthiolcarbamate; S-Ethyl diisobutylthiocarbamate; Stauffer R 1910;Sutan |
| CAS: | 2008-41-5 |
| EINECS: | 217-916-3 |
| Molecular Formula: | C11H23 N O S |
| Molecular Weight: | 217.371 |
| InChI: | InChI=1S/C11H23NOS/c1-6-14-11(13)12(7-9(2)3)8-10(4)5/h9-10H,6-8H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Melting Point: | 6 |
| Flash Point: | 123.3°C |
| Boiling Point: | 130 ºC (10 mmHg) |
| Density: | 0.9402 |
| Stability: | Apparently indefinite storage life under normal ambient conditions. Thermally stable up to 200 C. Hydrolyzed by strong acids and bases. |
| Refractive index: | 1.4689 (25 C) |
| Solubility: | 45 mg/L @ 22 C |
| Appearance: | Colorless liquid which darkens upon exposure to light, air and moisture. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29033080 |
| Flash Point: | 123.3°C |
| Storage Temperature: | 0-6°C |
| Color: | Colorless liquid |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
