| Identification | |
| Name: | 1H-Indazol-6-ol,3-methyl- |
| Synonyms: | 6-Hydroxy-3-methylindazole; |
| CAS: | 201286-99-9 |
| Molecular Formula: | C8H8N2O |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C8H8N2O/c1-5-7-3-2-6(11)4-8(7)10-9-5/h2-4,11H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.349 g/cm3 |
| Refractive index: | 1.719 |
| Specification: |
The 6-Hydroxy-3-methylindazole with the cas number 201286-99-9 is also called 1H-Indazol-6-ol,3-methyl-. The systematic name is 3-methyl-1H-indazol-6-ol. Its molecular formula is C8H8N2O. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.15; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 9; (6)ACD/BCF (pH 7.4): 9; (7)ACD/KOC (pH 5.5): 164; (8)ACD/KOC (pH 7.4): 163; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 48.91Å2; (13)Index of Refraction: 1.719; (14)Molar Refractivity: 43.326 cm3; (15)Molar Volume: 109.8 cm3; (16)Polarizability: 17.176×10-24cm3; (17)Surface Tension: 69.928 dyne/cm; (18)Enthalpy of Vaporization: 63.645 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
