| Identification | |
| Name: | 2,6-Xylyl ester of 1-piperidineacetic acid hydrochloride |
| Synonyms: | FC 403;2,6-Xylyl ester of 1-piperidineacetic acid hydrochloride;1-Piperidineacetic acid, 2,6-xylyl ester, hydrochloride;2,6-dimethylphenyl piperidin-1-ylacetate hydrochloride(1:1);2014-25-7;AC1L3SHJ;AC1Q60LF;AR-1D5046;LS-114158;(2,6-dimethylphenyl) 2-piperidin-1-ylacetate hydrochloride;2,6-dimethylphenyl piperidin-1-ylacetate hydrochloride (1:1) |
| CAS: | 2014-25-7 |
| Molecular Formula: | C15H21NO2 . ClH |
| Molecular Weight: | 283.7937 |
| InChI: | InChI=1/C15H21NO2.ClH/c1-12-7-6-8-13(2)15(12)18-14(17)11-16-9-4-3-5-10-16;/h6-8H,3-5,9-11H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 121.6°C |
| Boiling Point: | 348°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 121.6°C |
| Safety Data | |
 |
|
