| Identification | |
| Name: | 1-DODECYLAMINE ACETATE |
| Synonyms: | AMINODODECANE ACETATE;LAURYLAMINE ACETATE;DODECYLAMINE ACETATE;TIMTEC-BB SBB007640;N-DODECYLAMINE ACETATE;1-Dodecanamine,acetate;1-Dodecanamineacetate(salt);1-dodecylamineacetate |
| CAS: | 2016-56-0 |
| EINECS: | 217-956-1 |
| Molecular Formula: | C12H27N•C2H4O2 |
| Molecular Weight: | 245.46 |
| InChI: | InChI=1/C14H28O2.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15;/h3-13H2,1-2H3;1H3/p+1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 69°C |
| Flash Point: | 100.4°C |
| Boiling Point: | 258.6°Cat760mmHg |
| Density: | 0.804g/cm3 |
| Solubility: | Miscible in ethanol, ethyl ether, and benzene. In water, 0.078 g/l at 25 deg C and pH 11.8. |
| Specification: | Safety Statements:22-36/37/39 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 100.4°C |
| Color: | OIL |
| Safety Data | |
 |
|
