Identification |
Name: | Benzothiazole,2-hydrazinyl-4-methyl- |
Synonyms: | 2(3H)-Benzothiazolone,4-methyl-, hydrazone (9CI);Benzothiazole, 2-hydrazino-4-methyl- (6CI,8CI);2-Hydrazino-4-methyl-1,3-benzothiazole;2-Hydrazino-4-methylbenzothiazole;4-Methyl-2-hydrazinobenzothiazole; |
CAS: | 20174-68-9 |
EINECS: | 243-562-4 |
Molecular Formula: | C8H9N3S |
Molecular Weight: | 179.24 |
InChI: | InChI=1/C8H9N3S/c1-5-3-2-4-6-7(5)10-8(11-9)12-6/h2-4H,9H2,1H3,(H,10,11) |
Molecular Structure: |
 |
Properties |
Density: | 1.387g/cm3 |
Refractive index: | 1.774 |
Appearance: | white needle-like crystals |
Specification: |
4-Methyl-2-benzothiazolehydrazine , its cas register number is 20174-68-9. It also can be called 2(3H)-Benzothiazolone, 4-methyl-, hydrazone ; Benzothiazole, 2-hydrazinyl-4-methyl- ; and 4-Methylbenzothiazol-2(3H)-one hydrazone .
|
Safety Data |
|
 |