| Identification | |
| Name: | N-Acetyl-L-phenylalanine |
| Synonyms: | Acetylphenylalanine;(2S)-2-acetamido-3-phenyl-propanoic acid;Alanine, N-acetyl-3-phenyl-, L-;L-N-Acetylphenylalanine;Ac-Phe-OH;L-Phenylalanine, N-acetyl-;(2S)-2-acetamido-3-phenyl-propanoate;N-Acetyl-3-phenyl-L-alanine;Acetyl-L-phenylalanine;N-Acetylphenylalanine;Alanine, N-acetyl-3-phenyl-, L- (8CI);H-Phe-OH; |
| CAS: | 2018-61-3 |
| EINECS: | 217-959-8 |
| Molecular Formula: | C11H13NO3 |
| Molecular Weight: | 207.23 |
| InChI: | InChI=1/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.199 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 40 o (C=1,METHANOL) |
| Appearance: | White powder. |
| Specification: |
?N-Acetyl-L-phenylalanine (CAS NO.2018-61-3) is also named as Acetyl-L-phenylalanine ; Acetylphenylalanine ; L-N-Acetylphenylalanine ; N-Acetylphenylalanine ; NSC 45699?; Alanine, N-acetyl-3-phenyl-, L- (8CI) ; L-Phenylalanine, N-acetyl- ; N-Acetyl-3-phenyl-L-alanine .?It is white to off-white fine cryst. powder or needles. |
| Safety Data | |
 |
|
