| Identification | |
| Name: | Benzenamine,2-bromo-6-chloro-4-fluoro- |
| Synonyms: | 2-Bromo-6-chloro-4-fluoroaniline |
| CAS: | 201849-14-1 |
| Molecular Formula: | C6H4BrClFN |
| Molecular Weight: | 224.458 |
| InChI: | InChI=1S/C6H4BrClFN/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.809 g/cm3 |
| Refractive index: | 1.55 |
| Appearance: | solid |
| Specification: |
2-Bromo-6-chloro-4-fluoroaniline (201849-14-1) is known as Aniline derivate,is the chemical compound with the formula C6H4BrClFN. Its structure contains fluorine, chlorine and bromine,so it is toxic and irritant.We have to be careful when use it. 2-Bromo-6-chloro-4-fluoroaniline (201849-14-1) can be very good used as raw material in organic synthesis. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
