| Identification | |
| Name: | N-BUTYL-1,2,3,6-TETRAHYDRONAPHTH-ALIMIDE |
| Synonyms: | 2-Butyl-3a,4,7,7a-tetrahydro-1H-isoindole-1,3(2H)-dione |
| CAS: | 2021-19-4 |
| Molecular Formula: | C12H17NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H17NO2/c1-2-3-8-13-11(14)9-6-4-5-7-10(9)12(13)15/h4-5,9-10H,2-3,6-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.8°C |
| Boiling Point: | 341.5°C at 760 mmHg |
| Density: | 1.098g/cm3 |
| Refractive index: | 1.515 |
| Specification: |
N-Butyl-1,2,3,6-tetrahydronaphthalimide , its cas register number is 2021-19-4. It also can be called AI3-04145 ; NSC 16066 ; NSC 69968 ; 1H-Isoindole-1,3(2H)-dione, 2-butyl-3a,4,7,7a-tetrahydro- (9CI) ; 4-Cyclohexene-1,2-dicarboximide, N-butyl- . It is toxic by ingestion and skin contact. When heated to decomposition it emits toxic vapors of NOx. The storage environment of N-Butyl-1,2,3,6-tetrahydronaphthalimide (CAS NO.2021-19-4) should be ventilate, low-temperature and dry. |
| Flash Point: | 148.8°C |
| Safety Data | |
 |
|
