| Identification | |
| Name: | 1,2-Benzenediol, sodiumsalt (1:?) |
| Synonyms: | 1,2-Benzenediol,sodium salt (9CI); Pyrocatechol, sodium salt (8CI) |
| CAS: | 20244-21-7 |
| EINECS: | 243-637-1 |
| Molecular Formula: | C6H6 O2 . x Na |
| Molecular Weight: | 176.10197 |
| InChI: | InChI=1/C6H6O2.Na/c7-5-3-1-2-4-6(5)8;/h1-4,7-8H;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 105 deg C |
| Flash Point: | 137.2°C |
| Boiling Point: | 245.5°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Sol in chloroform, ether; very sol in pyridine, ... aqueous alkalis. Slightly sol in cold benzene; sol in carbon tetrachloride, and hot benzene. Soluble in alcohol, ether, acetate In water, 4.61X10+5 mg/L at 25 deg C |
| Flash Point: | 137.2°C |
| Color: | Monoclinic tablets, prisms from toluene Colorless crystals, discolors to brown on exposure to air and light, especially when moist |
| Safety Data | |
 |
|
