| Identification | |
| Name: | Anthracene, 2-ethenyl- |
| Synonyms: | Anthracene,2-vinyl- (6CI,7CI,8CI);2-Ethenylanthracene;2-Vinylanthracene; |
| CAS: | 2026-16-6 |
| Molecular Formula: | C16H12 |
| Molecular Weight: | 204.27 |
| InChI: | InChI=1/C16H12/c1-2-12-7-8-15-10-13-5-3-4-6-14(13)11-16(15)9-12/h2-11H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.112 g/cm3 |
| Refractive index: | 1.724 |
| Appearance: | Light Yellow Powder |
| Specification: |
The 2-Vinylanthracene with the CAS number 2026-16-6 is also called Anthracene, 2-ethenyl-. Both the systematic name and IUPAC name are 2-ethenylanthracene. Its molecular formula is C16H12. This chemical belongs to the following product categories: (1)Aromatics Compounds; (2)Aromatics. It is used in cationic polymerization. The properties of the 2-Vinylanthracene are: (1)ACD/LogP: 5.16; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.16; (4)ACD/LogD (pH 7.4): 5.16; (5)ACD/BCF (pH 5.5): 4925.28; (6)ACD/BCF (pH 7.4): 4925.28; (7)ACD/KOC (pH 5.5): 15298; (8)ACD/KOC (pH 7.4): 15298; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 0 Å2; (13)Index of Refraction: 1.724; (14)Molar Refractivity: 72.86 cm3; (15)Molar Volume: 183.6 cm3; (16)Polarizability: 28.88×10-24cm3; (17)Surface Tension: 46.6 dyne/cm; (18)Enthalpy of Vaporization: 60.02 kJ/mol; (19)Vapour Pressure: 1.51×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Usage: | Used in cationic polymerization |
| Safety Data | |
 |
|
