| Identification | |
| Name: | Naphthalene,2-(1-methylethyl)- |
| Synonyms: | Naphthalene,2-isopropyl- (6CI,7CI,8CI); 2-Isopropylnaphthalene; NSC 166466; b-Isopropylnaphthalene |
| CAS: | 2027-17-0 |
| EINECS: | 217-976-0 |
| Molecular Formula: | C13H14 |
| Molecular Weight: | 170.25 |
| InChI: | InChI=1/C13H14/c1-10(2)12-8-7-11-5-3-4-6-13(11)9-12/h3-10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 109.7°C |
| Density: | 0.98g/cm3 |
| Refractive index: | 1.5870 |
| Solubility: | Insoluble in water; very soluble in ethanol, ethyl ether; soluble in benzene. |
| Specification: |
2-Isopropylnaphthalene (CAS NO.2027-17-0) also can be called Naphthalene, 2-(1-methylethyl)- ; .beta.-Isopropylnaphthalene ; 2-propan-2-ylnaphthalene ; and 2-iso-Propylnaphthalene . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 109.7°C |
| Color: | Clear, yellowish-brown liquid Colorless liquid |
| Safety Data | |
 |
|
