Identification |
Name: | 4H-Cyclopenta[def]phenanthrene |
Synonyms: | 4,5-Methylenephenanthrene;4,5-Phenanthrylenemethane; Benzo[def]fluorene; Methane, 4,5-phenanthrylene-;Methylenephenanthrene; NSC 88888; Phenanthrene, 4,5-methylene- |
CAS: | 203-64-5 |
EINECS: | 205-905-6 |
Molecular Formula: | C15H10 |
Molecular Weight: | 190.25 |
InChI: | InChI=1/C15H10/c1-3-10-7-8-11-4-2-6-13-9-12(5-1)14(10)15(11)13/h1-8H,9H2 |
Molecular Structure: |
![(C15H10) 4,5-Methylenephenanthrene;4,5-Phenanthrylenemethane; Benzo[def]fluorene; Methane, 4,5-phenanthrylene...](https://img1.guidechem.com/chem/e/dict/2/203-64-5.jpg) |
Properties |
Transport: | 2811 |
Melting Point: | 113-115 ºC(lit.) |
Flash Point: | 168.8 ºC |
Boiling Point: | 353 ºC(lit.) |
Density: | 1.257 g/cm3 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
Refractive index: | 1.803 |
Water Solubility: | negligible |
Solubility: | negligible |
Appearance: | white crystals |
Specification: |
4H-Cyclopenta(def)phenanthrene (CAS NO.203-64-5) is also called 4,5-Methylenephenanthrene ; 4,5-Phenanthrylenemethane ; Benzo(def)fluorene ;Cyclopenta[def]phenanthrene ; Cyclopentaphenanthrene . 4H-Cyclopenta(def)phenanthrene (CAS NO.203-64-5) is stable and combustible. It is incompatible with strong oxidizing agents.
|
Packinggroup: | III |
Flash Point: | 168.8 ºC |
Safety Data |
|
![](/images/detail_15.png) |