| Identification | |
| Name: | 3,3-diethoxypropiononitrile |
| Synonyms: | Acetaldehyde,cyano-, diethyl acetal (6CI,7CI,8CI); 3,3-Diethoxypropanenitrile;3,3-Diethoxypropionitrile; Cyanoacetaldehyde diethylacetal;Malonaldehydenitrile diethyl acetal |
| CAS: | 2032-34-0 |
| EINECS: | 217-988-6 |
| Molecular Formula: | C7H13NO2 |
| Molecular Weight: | 143.18 |
| InChI: | InChI=1/C7H13NO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3275 |
| Melting Point: | 82-84 |
| Flash Point: | 183? |
| Density: | 0.954 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.415 |
| Solubility: | Slightly soluble |
| Appearance: | Clear yellow to brown liquid. |
| Specification: |
Propanenitrile,3,3-diethoxy- , its cas register number is 2032-34-0. It also can be called 3,3-Diethoxypropionitrile ; 1,1-Diethoxy-2-cyanoethane ; 2-Cyanoacetaldehyde diethylacetal .It is a clear yellow to brown liquid. |
| Packinggroup: | I; II; III |
| HS Code: | 29269095 |
| Flash Point: | 183? |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
