Identification |
Name: | [1,1'-Biphenyl]-4,4'-diamine,3,3'-dimethoxy-, hydrochloride (1:2) |
Synonyms: | Benzidine,3,3'-dimethoxy-, dihydrochloride (8CI);[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethoxy-,dihydrochloride (9CI);C.I. DisperseBlack 6 dihydrochloride;o-Dianisidine dihydrochloride; |
CAS: | 20325-40-0 |
EINECS: | 243-737-5 |
Molecular Formula: | C14H16N2O2.2HCl |
Molecular Weight: | 317.21 |
InChI: | InChI=1/C14H16N2O2.2ClH/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;;/h3-8H,15-16H2,1-2H3;2*1H |
Molecular Structure: |
![(C14H16N2O2.2HCl) Benzidine,3,3'-dimethoxy-, dihydrochloride (8CI);[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethoxy-,dihyd...](https://img.guidechem.com/casimg/20325-40-0.jpg) |
Properties |
Transport: | 2811 |
Stability: | Stable under normal temperatures and pressures. |
Solubility: | Soluble |
Appearance: | Off-white powder. |
Packinggroup: | II |
Color: | LEAFLETS OR NEEDLES FROM WATER Colorless crystals that turn a violet color on standing. |
Safety Data |
Hazard Symbols |
T:Toxic
|
|
 |