| Identification | |
| Name: | Methazole (2-(3,4-Dichlorophenyl)-4-methyl-1,2,4- oxadiazolidine-3,5-dione) |
| Synonyms: | 2-(3,4-Dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione;Bioxone; Chlormethazole; Metazol; Metazole; Methazole; Mezopur; Probe; Probe75; Tunic; Tunic (pesticide); VCS 438 |
| CAS: | 20354-26-1 |
| EINECS: | 243-761-6 |
| Molecular Formula: | C9H6 Cl2 N2 O3 |
| Molecular Weight: | 261.062 |
| InChI: | InChI=1S/C9H6Cl2N2O3/c1-12-8(14)13(16-9(12)15)5-2-3-6(10)7(11)4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 123-124 deg C |
| Density: | 1.602 g/cm3 |
| Refractive index: | 1.618 |
| Solubility: | @ 25 DEG C: 1.5 MG/L WATER, 40 G/L ACETONE, 6.5 G/L METHANOL, 55 G/L XYLENE @ 25 deg C in ethanol approx equal to 1.0% wt/wt |
| Specification: |
Methazole (CAS NO.20354-26-1) is a colorless crystals to light tan solid and it is non corrosive. It hydrolyzed by strong acids and bases. Also it is a herbicide in the family of herbicides known as oxadiazolones. |
| Storage Temperature: | 0-6°C |
| Color: | White solid |
| Safety Data | |
 |
|
