| Identification | |
| Name: | hexamethylenetetramine, compound with 1-chloro-2,3-epoxypropane |
| Synonyms: | 1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane, compd. with 2-(chloromethyl)oxirane (1:?);Hexamethylenetetramine, compound with 1-chloro-2,3-epoxypropane;1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane, compd. with (chloromethyl)oxirane;Hexamethylenetetramine, compd. with 1-chloro-2,3-epoxypropane;1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decanato - 2-(chloromethyl)oxiranato (1:1) |
| CAS: | 20368-76-7 |
| EINECS: | 243-770-5 |
| Molecular Formula: | C9H17ClN4O |
| Molecular Weight: | 232.7105 |
| InChI: | InChI=1/C6H12N4.C3H5ClO/c1-7-2-9-4-8(1)5-10(3-7)6-9;4-1-3-2-5-3/h1-6H2;3H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.9°C |
| Boiling Point: | 252.7°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 103.9°C |
| Safety Data | |
 |
|
