| Identification | |
| Name: | Benzene,1-bromo-3-ethenyl- |
| Synonyms: | Styrene,m-bromo- (6CI,7CI,8CI);1-Bromo-3-ethenylbenzene;1-Bromo-3-vinylbenzene;3-Bromovinylbenzene;3-Vinylbromobenzene;m-Bromostyrene;1-bromo-3-ethenylbenzene;Benzene, 1-bromo-3-ethenyl-; |
| CAS: | 2039-86-3 |
| EINECS: | 218-025-2 |
| Molecular Formula: | C8H7Br |
| Molecular Weight: | 183.04 |
| InChI: | InChI=1/C8H7Br/c1-2-7-4-3-5-8(9)6-7/h2-6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | clear colorless to yellow liquid |
| Density: | 1.406 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.591 |
| Solubility: | Insoluble |
| Appearance: | Yellow liquid. |
| Specification: |
3-Bromostyrene , its cas register number is 2039-86-3. It also can be called Benzene,1-bromo-3-ethenyl- ; 3-Vinylbromobenzene ; m-Bromostyrene .It is a clear colorless to yellow liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Refrigerator (approx 4 C). |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
