| Identification | |
| Name: | 2-Chloro-6-fluorophenol |
| Synonyms: | 2-chloro-6-fluoro-phenol; |
| CAS: | 2040-90-6 |
| EINECS: | 433-890-8 |
| Molecular Formula: | C6H4ClFO |
| Molecular Weight: | 146.55 |
| InChI: | InChI=1/C6H4ClFO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.408 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5231 |
| Appearance: | Clear very slight yellow. |
| Specification: |
?2-Chloro-6-fluorophenol , its cas register number is 2040-90-6. It also can be called Phenol, 2-chloro-6-fluoro- . |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
