Identification |
Name: | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
Synonyms: | H-Indol-2-one, 3-((3,5-dimethyl-1H-pyrrol-2-yl)methylene)-1,3-dihydro-;Semaxinib;SU5416;SU 5416; |
CAS: | 204005-46-9 |
Molecular Formula: | C15H14N2O |
Molecular Weight: | 238.28446 |
InChI: | InChI=1S/C15H14N2O/c1-9-7-10(2)16-14(9)8-12-11-5-3-4-6-13(11)17-15(12)18/h3-8,16H,1-2H3,(H,17,18)/b12-8- |
Molecular Structure: |
|
Properties |
Flash Point: | 244.9 °C |
Boiling Point: | 481.4 °Cat760mmHg |
Density: | 1.256 g/cm3 |
Water Solubility: | H2O: insoluble |
Solubility: | H2O: insoluble |
Appearance: | yellow to yellow orange |
Specification: |
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one , its cas register number 204005-46-9. It also can be called (3Z)-3-[(3,5-Dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one .
|
Flash Point: | 244.9 °C |
Safety Data |
|
|