| Identification | |
| Name: | Diethanolamine 2-methyl-4-chlorophenoxyacetate |
| Synonyms: | bis(2-hydroxyethyl)ammonium 4-chloro-o-tolyloxyacetate |
| CAS: | 20405-19-0 |
| EINECS: | 243-792-5 |
| Molecular Formula: | C9H9ClO3 . C4H11NO2 |
| Molecular Weight: | 305.7546 |
| InChI: | InChI=1/C9H9ClO3.C4H11NO2/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;6-3-1-5-2-4-7/h2-4H,5H2,1H3,(H,11,12);5-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 151.6°C |
| Boiling Point: | 327°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Diethanolamine 2-methyl-4-chlorophenoxyacetate with cas registry number of 20405-19-0 is also named as (2-Methyl-4-chlorophenoxy)acetic acid, diethanolamine salt ; Caswell No. 557E ; EPA Pesticide Chemical Code 030511 ; MCPA diethanolamine salt ; MCPA-diolamine ; MCPA-diolamine [ISO] ; Acetic acid, ((4-chloro-o-tolyl)oxy)-, compd. with 2,2'-iminodiethanol (1:1) ; Acetic acid, (4-chloro-2-methylphenoxy)-, compd. with 2,2'-iminobis(ethanol) (1:1) ; Bis(2-hydroxyethyl)ammonium 4-chloro-o-tolyloxyacetate . |
| Flash Point: | 151.6°C |
| Safety Data | |
 |
|
