| Identification |
| Name: | 2-Bromobenzonitrile |
| Synonyms: | 2-bromo-benzonitril; Benzonitrile, o-bromo-; o-bromo-benzonitril; BROMOBENZONITRILE(2-); BROMOBENZONITRILE; OBBN; TIMTEC-BB SBB008569; o-Bromobenzonitrile 2-Bromobenzonitrile; 2-Bromo; 2-cyanobromobenzene; 2-Brombenzonitril; o-bromocyanobenzene; o-Bromobenzonitrile |
| CAS: | 2042-37-7 |
| EINECS: | 218-045-1 |
| Molecular Formula: | C7H4BrN |
| Molecular Weight: | 182.02 |
| InChI: | InChI=1/C7H4BrN/c8-7-4-2-1-3-6(7)5-9/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | > 110 C |
| Density: | 1.496 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.606 |
| Water Solubility: | Insoluble (soluble in alcohol and ether) AUTOIGNITION |
| Solubility: | Insoluble (soluble in alcohol and ether) AUTOIGNITION |
| Appearance: | white to pale yellow crystalline powder |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Flash Point: | > 110 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
