| Identification | |
| Name: | 1,2-Ethanediamine,N1,N1-dimethyl-N2-phenyl-N2-(phenylmethyl)-, hydrochloride (1:1) |
| Synonyms: | 1,2-Ethanediamine,N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)-, monohydrochloride (9CI);Ethylenediamine, N-benzyl-N',N'-dimethyl-N-phenyl-, hydrochloride (7CI,8CI);Antergan hydrochloride; N-Benzyl-N',N'-dimethyl-N-phenylethylenediaminehydrochloride; Phenbenzamine chloride; Phenbenzamine hydrochloride |
| CAS: | 2045-52-5 |
| Molecular Formula: | C17H22 N2 . Cl H |
| Molecular Weight: | 290.83092 |
| InChI: | InChI=1S/C17H22N2.ClH/c1-18(2)13-14-19(17-11-7-4-8-12-17)15-16-9-5-3-6-10-16;/h3-12H,13-15H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 210 - 211 C |
| Flash Point: | 166.2°C |
| Boiling Point: | 375.9°C at 760 mmHg |
| Water Solubility: | moderate Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology May be harmful if swallowed, inhaled or absorbed through the skin. Toxicity data |
| Solubility: | moderate
|
| Appearance: | beige crystalline powder |
| Specification: |
N-Phenyl-N-benzyl-N',N'-dimethylethylenediamine hydrochloride , its cas register number is 2045-52-5. It also can be called Antergan hydrochloride ; Phenbenzamine hydrochloride ; and N-Dimethylaminoethylbenzylaniline hydrochloride . |
| Flash Point: | 166.2°C |
| Safety Data | |
 |
|
