| Identification |
| Name: | 5-Thiazolecarboxylicacid, 4-methyl- |
| Synonyms: | 4-Methyl-1,3-thiazole-5-carboxylicacid;4-Methyl-5-thiazolecarboxylic acid; |
| CAS: | 20485-41-0 |
| Molecular Formula: | C5H5NO2S |
| Molecular Weight: | 143.16 |
| InChI: | InChI=1/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 137.4 oC |
| Boiling Point: | 303.6 oC at 760 mmHg |
| Density: | 1.418 g/cm3 |
| Stability: | Stable at normal temperratures and pressures. |
| Refractive index: | 1.611 |
| Solubility: | 14 g/L (25 C) |
| Appearance: | white to light yellow crystal powder |
| Flash Point: | 137.4 oC |
| Storage Temperature: | Keep container tightly closed. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
