| Identification | |
| Name: | Propanedioic acid,2-(2-propen-1-yl)-, 1,3-diethyl ester |
| Synonyms: | Malonicacid, allyl-, diethyl ester (6CI,7CI,8CI); Propanedioic acid, 2-propenyl-,diethyl ester (9CI); (2-Propenyl)propanedioic acid diethyl ester;2-Allylmalonic acid diethyl ester; Allylmalonic acid diethyl ester; Diethyl1-butene-4,4-dicarboxylate; Diethyl 2-allyl-1,3-propanedioate; Diethyl2-allylmalonate; Diethyl 2-prop-2-enylmalonate; Diethyl 2-propenylmalonate;Diethyl allylmalonate; Ethyl allylmalonate; NSC 67393; NSC 8777 |
| CAS: | 2049-80-1 |
| EINECS: | 218-072-9 |
| Molecular Formula: | C10H16 O4 |
| Molecular Weight: | 200.23 |
| InChI: | InChI=1/C10H16O4/c1-4-7-8(9(11)13-5-2)10(12)14-6-3/h4,8H,1,5-7H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.015 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.43-1.432 |
| Solubility: | Insoluble |
| Appearance: | Clear to pale yellow liquid |
| Specification: |
Propanedioic acid, 2-(2-propen-1-yl)-, 1,3-diethyl ester (CAS NO.2049-80-1) is also named as AI3-11069 ; Diethyl 2-(2-propenyl)-1,3-propanedioate ; Diethyl 2-(prop-2-enyl)malonate ; Diethyl 2-allylmalonate ; Diethyl allylmalonate ; Diethyl prop-2-enylpropanedioate ; Ethyl allylmalonate ; Malonic acid, allyl-, diethyl ester ; NSC 67393 ; NSC 8777 ; Propanedioic acid, 2-propenyl-, diethyl ester . Propanedioic acid, 2-(2-propen-1-yl)-, 1,3-diethyl ester (CAS NO.2049-80-1) is clear colorless to slightly yellow liquid. |
| HS Code: | 29171990 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
