| Identification | |
| Name: | Octanedioic acid,1,8-diethyl ester |
| Synonyms: | Octanedioicacid, diethyl ester (9CI); Suberic acid, diethyl ester (6CI,7CI,8CI); Diethyloctanedioate; Diethyl suberate; NSC 62701 |
| CAS: | 2050-23-9 |
| EINECS: | 218-084-4 |
| Molecular Formula: | C12H22 O4 |
| Molecular Weight: | 230.30 |
| InChI: | InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.98 |
| Refractive index: | n20/D 1.432(lit.) |
| Water Solubility: | immiscible IN Water |
| Solubility: | immiscible IN Water |
| Appearance: | colourless liquid |
| Specification: | clear colourless to yellowish liquid Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
 |
|
