| Identification |
| Name: | 1-Naphthalenol,2,4-dichloro- |
| Synonyms: | 1-Naphthol,2,4-dichloro- (6CI,7CI,8CI);2,4-Dichloro-1-naphthol;2,4-Dichloro-a-naphthol;2,4-Dichloronaphthol;NSC 6322; |
| CAS: | 2050-76-2 |
| EINECS: | 218-103-6 |
| Molecular Formula: | C10H6Cl2O |
| Molecular Weight: | 213.062 |
| InChI: | InChI=1/C10H6Cl2O/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,13H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | off-white to tan powder |
| Boiling Point: | 340.2°Cat760mmHg |
| Density: | 1.46g/cm3 |
| Refractive index: | 1.69 |
| Appearance: | beige-yellowish crystalline powder |
| Flash Point: | off-white to tan powder |
| Storage Temperature: | 2-8°C |
| Color: | off-white to tan |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
