Identification |
Name: | 1-Naphthalenol,2,4-dichloro- |
Synonyms: | 1-Naphthol,2,4-dichloro- (6CI,7CI,8CI);2,4-Dichloro-1-naphthol;2,4-Dichloro-a-naphthol;2,4-Dichloronaphthol;NSC 6322; |
CAS: | 2050-76-2 |
EINECS: | 218-103-6 |
Molecular Formula: | C10H6Cl2O |
Molecular Weight: | 213.062 |
InChI: | InChI=1/C10H6Cl2O/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,13H |
Molecular Structure: |
 |
Properties |
Flash Point: | off-white to tan powder |
Boiling Point: | 340.2°Cat760mmHg |
Density: | 1.46g/cm3 |
Refractive index: | 1.69 |
Appearance: | beige-yellowish crystalline powder |
Flash Point: | off-white to tan powder |
Storage Temperature: | 2-8°C |
Color: | off-white to tan |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |