| Identification | |
| Name: | 1,1'-Biphenyl,2-chloro- |
| Synonyms: | Biphenyl,2-chloro- (6CI,7CI,8CI); 1-Chloro-2-phenylbenzene; 2-Chloro-1,1'-biphenyl;2-Chlorobiphenyl; 2-Chlorodiphenyl; 2-Monochlorobiphenyl; NSC 67354; PCB 1;o-Chlorobiphenyl |
| CAS: | 2051-60-7 |
| EINECS: | 218-125-6 |
| Molecular Formula: | C12H9 Cl |
| Molecular Weight: | 188.66 |
| InChI: | InChI=1/C12H9Cl/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN No 343 |
| Melting Point: | 32-34ºC |
| Density: | 1.131 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.583 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | powder |
| Specification: |
2-Chlorobiphenyl with CAS registry number of 2051-60-7 is also known as 2-Chloro-1,1'-biphenyl ; 2-Chlorodiphenyl ; 2-Monochlorobiphenyl ; NSC 67354 ; o-Chlorobiphenyl ; o-Chlorodiphenyl ; 1,1'-Biphenyl, 2-chloro- ; 1,1'-Biphenyl, 2-chloro- (9CI) ; Biphenyl, 2-chloro- . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
 |
|
