| Identification | |
| Name: | 4-Chloro-1,1'-biphenyl |
| Synonyms: | - |
| CAS: | 2051-62-9 |
| EINECS: | 218-127-7 |
| Molecular Formula: | C12H9Cl |
| Molecular Weight: | 188.66 |
| InChI: | InChI=1/C12H9Cl/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3432 |
| Flash Point: | 127°C |
| Density: | 1.131g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.583 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | clear to yellowish crystalline powder |
| Packinggroup: | III |
| Flash Point: | 127°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
