| Identification | |
| Name: | Benzene,1-bromo-4-(2-methylpropyl)- |
| Synonyms: | Benzene,1-bromo-4-isobutyl- (6CI,7CI); 1-Bromo-4-isobutylbenzene;4-Bromoisobutylbenzene; 4-Isobutylbromobenzene; 4-Isobutylphenyl bromide;p-Isobutylbromobenzene |
| CAS: | 2051-99-2 |
| Molecular Formula: | C10H13 Br |
| Molecular Weight: | 213.11 |
| InChI: | InChI=1/C10H13Br/c1-8(2)7-9-3-5-10(11)6-4-9/h3-6,8H,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 96.6°C |
| Boiling Point: | 237°Cat760mmHg |
| Density: | 1.24g/cm3 |
| Refractive index: | 1.525 |
| Specification: |
1-Bromo-4-isobutylbenzene , with CAS number of 2051-99-2, can be called 4-Bromoisobutylbenzene ; 1-bromo-4-isobutylbenzene ; p-bromo-iso-butylbenzene ; p-bromisobutylbenzene ; benzene,1-(2-methylpropyl)-4-bromo- ; 1-isobutyl-4-bromobenzene ; 1-bromo-4-(2-methylpropyl)benzene . |
| Flash Point: | 96.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
