| Identification | |
| Name: | 9H-Purine,6-chloro-9-(2-C-methyl-b-D-ribofuranosyl)- |
| Synonyms: | 6-CHLORO-9-(2-METHYL-BETA-D-RIBOFURANOSYL)-9H-PURINE;6-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine |
| CAS: | 205171-05-7 |
| Molecular Formula: | C11H13ClN4O4 |
| Molecular Weight: | 300.70 |
| InChI: | InChI=1/C11H13ClN4O4/c1-11(19)7(18)5(2-17)20-10(11)16-4-15-6-8(12)13-3-14-9(6)16/h3-5,7,10,17-19H,2H2,1H3/t5-,7-,10-,11-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.86 g/cm3 |
| Refractive index: | 1.779 |
| Specification: |
The CAS registry number of 6-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine is 205171-05-7. It is also named as 9H-purine, 6-chloro-9-(2-C-methyl-beta-D-ribofuranosyl)- . 6-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine is a kind of purine. Purines, including substituted purines and their tautomers, are the most widely distributed kind of nitrogen-containing heterocycle in nature. Aside from DNA and RNA, purines are biochemically significant components in a number of other important biomolecules, such as ATP, GTP, cyclic AMP, NADH, and coenzyme A. Purine itself, has not been found in nature, but it can be produced by organic synthesis. |
| Safety Data | |
 |
|
