| Identification | |
| Name: | Benzoic acid,2-hydroxy-, butyl ester |
| Synonyms: | Salicylicacid, butyl ester (6CI,7CI,8CI);Butyl 2-hydroxybenzoate;Butylo-hydroxybenzoate;NSC 1511;NSC 403676;n-Butyl salicylate; |
| CAS: | 2052-14-4 |
| EINECS: | 218-142-9 |
| Molecular Formula: | C11H14O3 |
| Molecular Weight: | 194.23 |
| InChI: | InChI=1/C11H14O3/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12/h4-7,12H,2-3,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107°C |
| Density: | 1.08 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.5120 |
| Solubility: | Insoluble |
| Specification: |
n-Butyl salicylate (2052-14-4) also can be called Butyl 2-hydroxybenzoate ; Butyl O-hydroxybenzoate ; Butyl salicylate ; Butyl hydroxybenzoate ; n-Butyl o-hydroxybenzoate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 107°C |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Flavoring. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
