| Identification | |
| Name: | 1,4-Benzenediamine,N1,N1-dimethyl-, hydrochloride (1:1) |
| Synonyms: | 1,4-Benzenediamine,N,N-dimethyl-, monohydrochloride (9CI); p-Phenylenediamine, N,N-dimethyl-, monohydrochloride(8CI); N,N-Dimethyl-1,4-benzenediamine hydrochloride;N,N-Dimethyl-1,4-phenylenediamine monohydrochloride;N,N-Dimethyl-p-phenylenediamine monohydrochloride; p-Amino-N,N-dimethylanilinemonohydrochloride |
| CAS: | 2052-46-2 |
| EINECS: | 218-146-0 |
| Molecular Formula: | C8H12 N2 . Cl H |
| Molecular Weight: | 172.658 |
| InChI: | InChI=1/C8H12N2.ClH/c1-10(2)8-5-3-7(9)4-6-8;/h3-6H,9H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Melting Point: | 215 °C (dec.)(lit.) |
| Flash Point: | 84.2°C |
| Boiling Point: | 211.6°Cat760mmHg |
| Density: | 0.94g/cm3 |
| Solubility: | Soluble in water; very soluble in ethanol, ethyl ether, benzene. Sol in water, alcohol, chloroform, ether |
| Specification: |
N,N-Dimethyl-P-Phenylenediamine Monohydrochloride (CAS NO.2052-46-2) is a brown-black to black crystalline powder. To protect yourself,you can put on eyeshields, faceshields, gloves, type P2 (EN 143) respirator cartridges. When exposed to air, it darkens readily to grey powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 84.2°C |
| Storage Temperature: | −20°C |
| Color: | Reddish-violet crystals NEEDLES FROM BENZENE Colorless; asbestos-like needles |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
