| Identification |
| Name: | 4H-1-Benzopyran-4-one,2-(4-bromophenyl)- |
| Synonyms: | Flavone,4'-bromo- (8CI);4'-Bromoflavone; |
| CAS: | 20525-20-6 |
| Molecular Formula: | C15H9BrO2 |
| Molecular Weight: | 301.1348 |
| InChI: | InChI=1S/C15H9BrO2/c16-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-9H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.54 g/cm3 |
| Usage: | An aryl hydrocarbon hydroxylase inducer. Used as a phase II detoxifying enzymes, quninone reductase and glutathione S-transferase in cell culture and in different tissues of rats |
| Safety Data |
| |
 |
